| Identification | |
| Name: | Phenol,3-(dimethylamino)-, methylcarbamate (ester), monohydrochloride (9CI) |
| Synonyms: | 3-(Dimethylamino)phenyl methylcarbamate hydrochloride (1:1);phenol, 3-(dimethylamino)-, methylcarbamate (ester), hydrochloride (1:1) |
| CAS: | 63982-40-1 |
| Molecular Formula: | C10H14 N2 O2 . Cl H |
| Molecular Weight: | 230.72 |
| InChI: | InChI=1/C10H14N2O2.ClH/c1-11-10(13)14-9-6-4-5-8(7-9)12(2)3;/h4-7H,1-3H3,(H,11,13);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134°C |
| Boiling Point: | 298°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Methylcarbamic ester of 3-oxyphenyldimethylamine (CAS NO.63982-40-1) can also be called as AR-12 ; Methylcarbamic ester of 3-oxyphenyldimethylamine hydrochloride ; N-Methylurethane of hydrochloride of 3-dimethylaminophenol ; Carbamic acid, N-methyl-,3-(dimethylamino)phenyl ester,hydrochloride . |
| Flash Point: | 134°C |
| Safety Data | |
 |
|
