| Identification | |
| Name: | 6-Aminocoumarin hydrochloride |
| Synonyms: | 6-Coumarinamine hydrochloride |
| CAS: | 63989-79-7 |
| Molecular Formula: | C9H8ClNO2 |
| Molecular Weight: | 197.62 |
| InChI: | InChI=1/C9H7NO2.ClH/c10-7-2-3-8-6(5-7)1-4-9(11)12-8;/h1-5H,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >260°C (dec.) |
| Flash Point: | 231°C |
| Boiling Point: | 396.9°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
6-Aminocoumarin hydrochloride , its cas register number is 63989-79-7. It also can be called Coumarin, 6-amino-, hydrochloride . 6-Aminocoumarin hydrochloride (CAS NO.63989-79-7) is harmful if swallowed. And it is irritating to eyes, respiratory system and skin. You should wear suitable protective clothing and gloves when contact with it. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Flash Point: | 231°C |
| Safety Data | |
 |
|
