| Identification | |
| Name: | Benzenemethanol, a-[1-(methylamino)ethyl]-,hydrochloride (1:1) |
| Synonyms: | Benzenemethanol,a-[1-(methylamino)ethyl]-,hydrochloride (9CI); CPDD 0046 |
| CAS: | 63991-26-4 |
| Molecular Formula: | C10H15 N O . Cl H |
| Molecular Weight: | 201.72 |
| InChI: | InChI=1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H |
| Molecular Structure: | ![(C10H15NO.ClH) Benzenemethanol,a-[1-(methylamino)ethyl]-,hydrochloride (9CI); CPDD 0046](https://img1.guidechem.com/chem/e/dict/46/63991-26-4.jpg) |
| Properties | |
| Flash Point: | 85.6°C |
| Boiling Point: | 255°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Ephedrinhydrochlorid , its cas register number is 63991-26-4. It also can be called Benzyl alcohol, alpha-(1-methylaminoethyl)-, hydrochloride ; and alpha-(1-(Methylamino)ethyl)benzyl alcohol hydrochloride . |
| Flash Point: | 85.6°C |
| Safety Data | |
 |
|
