| Identification | |
| Name: | Benzenemethanol, a-(1-aminoethyl)-3-hydroxy-4-methyl-,hydrochloride (1:1) |
| Synonyms: | Benzenemethanol,a-(1-aminoethyl)-3-hydroxy-4-methyl-,hydrochloride (9CI) |
| CAS: | 63991-31-1 |
| Molecular Formula: | C10H15 N O2 . Cl H |
| Molecular Weight: | 217.72 |
| InChI: | InChI=1S/C10H15NO2.ClH/c1-6-3-4-8(5-9(6)12)10(13)7(2)11;/h3-5,7,10,12-13H,11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
p-Methyl-m-hydroxy-phenyl-propanolamine hydrochloride , its cas register number is 63991-31-1. It also can be called 1-(3-Hydroxy-4-methylphenyl)-2-amino-1-propanol hydrochloride ; alpha-(1-Aminoethyl)-3-hydroxy-4-methylbenzyl alcohol hydrochloride . When p-Methyl-m-hydroxy-phenyl-propanolamine hydrochloride (CAS NO.63991-31-1) is heated to decomposition it emits very toxic fumes of HCl and NOx. |
| Safety Data | |
 |
|
