| Identification | |
| Name: | PHYSOSTIGMINE SULFATE |
| Synonyms: | (3as-cis)-amate(estersulfate(2:1)(salt);(3as-cis)-ylcarbamate(estersulfate(2:1);3-b)indole,1,2,3,3a,8,8a-hexahydro-5-hydroxy-1,3a,8-trimethyl-pyrrolo(meth;eserinesulphate;physostigmineso4;physostigminesulphate;ESERINE SULFATE;ESERINE HEMISULFATE |
| CAS: | 64-47-1 |
| EINECS: | 200-585-4 |
| Molecular Formula: | C30H42N6O4S |
| Molecular Weight: | 646.84 |
| InChI: | InChI=1/C15H21N3O2.H2O4S/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2;1-5(2,3)4/h5-6,9,13H,7-8H2,1-4H3,(H,16,19);(H2,1,2,3,4)/t13-,15+;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 1 |
| Flash Point: | 291°C |
| Boiling Point: | 557.5°C at 760 mmHg |
| Specification: |
Physostigmine sulfate ,its cas register number is 64-47-1. It also can be called Sulfuric acid compd. with physostigmine (1:2) ; (3aS-cis)-1,2,3,3a,8,8a-Hexahydro-1,3a,8-trimethylpyrrolo[2,3-b]indol-5-ol Methylcarbamate (Ester) Sulfate (2:1) ; and Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, methylcarbamate (ester), (3aS,8aR)-, sulfate (2:1) (salt) . |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| Biological Activity: | Cholinesterase inhibitor. |
| Flash Point: | 291°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
