| Identification | |
| Name: | 2,6-Piperidinedione,4-ethyl-4-methyl- |
| Synonyms: | Glutarimide,3-ethyl-3-methyl- (8CI); 2,6-Dioxo-4-methyl-4-ethylpiperidine;3-Ethyl-3-methylglutarimide; 3-Methyl-3-ethylglutarimide;4-Ethyl-4-methyl-2,6-dioxopiperidine; 4-Ethyl-4-methyl-2,6-piperidinedione;4-Methyl-4-ethyl-2,6-dioxopiperidine; Agipnon; Ahypnon; Antibarbi; Bemegrid;Bemegride; Etimid; Eukraton; Malysol; Megibal; Megimid; Megimide;Methetharimide; Mikedimide; NP 13; NSC 168667; NSC 58187; Zentraleptin; b-Ethyl-b-methylglutarimide; b-Methyl-b-ethylglutarimide |
| CAS: | 64-65-3 |
| EINECS: | 200-588-0 |
| Molecular Formula: | C8H13 N O2 |
| Molecular Weight: | 155.22 |
| InChI: | InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Melting Point: | 126-127 °C(lit.) |
| Flash Point: | 125.8°C |
| Boiling Point: | 282°C at 760 mmHg |
| Density: | 1.024g/cm3 |
| Refractive index: | 1.448 |
| Specification: |
3-Methyl-3-ethylglutarimide (CAS NO.64-65-3) is also called 2,6-Dioxo-4-methyl-4-ethylpiperidine ; 3-Ethyl-3-methylglutarimide ; 4-Ethyl-4-methyl-2,6-dioxopiperidine ; 4-Ethyl-4-methyl-2,6-piperidinedione ; 4-Methyl-4-ethyl-2,6-dioxopiperidine ; Bemegrida [INN-Spanish] ; Bemegride ; Bemegridum [INN-Latin] ; beta-Ethyl-beta-methylglutarimide ; beta-Methyl-beta-ethylglutarimide . 3-Methyl-3-ethylglutarimide (CAS NO.64-65-3) is insoluble in water. 3-Methyl-3-ethylglutarimide (CAS NO.64-65-3) is an amide. Amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). When heated to decomposition 3-Methyl-3-ethylglutarimide emits toxic fumes. Flash point data for 3-Methyl-3-ethylglutarimide are not available. 3-Methyl-3-ethylglutarimide is probably not flammable. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 125.8°C |
| Storage Temperature: | −20°C |
| Color: | white |
| Safety Data | |
 |
|
