| Identification | |
| Name: | Carbamic acid,N-nitroso-N-pentyl-, ethyl ester |
| Synonyms: | Carbamicacid, nitrosopentyl-, ethyl ester (9CI); N-Amyl-N-nitrosourethane;N-Nitroso-N-amylurethane |
| CAS: | 64005-62-5 |
| Molecular Formula: | C8H16 N2 O3 |
| Molecular Weight: | 188.26 |
| InChI: | InChI=1/C8H16N2O3/c1-3-5-6-7-10(9-12)8(11)13-4-2/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 91.4°C |
| Boiling Point: | 227.5°Cat760mmHg |
| Density: | 1.06g/cm3 |
| Refractive index: | 1.469 |
| Specification: |
N-Amyl-N-nitrosourethane (CAS NO.64005-62-5) is also named as CCRIS 1375 ; Carbamic acid, N-nitroso-N-pentyl-, ethyl ester ; Nitrosopentylcarbamic acid, ethyl ester . N-Amyl-N-nitrosourethane (CAS NO.64005-62-5) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 91.4°C |
| Safety Data | |
 |
|
