Identification |
Name: | Mercury,dibromo[tris(2-ethylhexyl) phosphite-P]- (9CI) |
Synonyms: | Phosphorusacid, tris(2-ethylhexyl) ester, mercury complex |
CAS: | 64011-37-6 |
Molecular Formula: | C24H51 Br2 Hg O3 P |
Molecular Weight: | 779.13 |
InChI: | InChI=1S/C24H51O3P.2BrH.Hg/c1-7-13-16-22(10-4)19-25-28(26-20-23(11-5)17-14-8-2)27-21-24(12-6)18-15-9-3;;;/h22-24H,7-21H2,1-6H3;2*1H;/q;;;+2/p-2 |
Molecular Structure: |
 |
Properties |
Specification: |
Mercury(II) bromide complex with tris(2-ethylhexyl) phosphite , its cas register number is 64011-37-6. It also can be called Phosphorous acid, tris(2-ethylhexyl) ester, complex with mercury(II) bromide (1:1) .
|
Report: |
Mercury and its compounds are on the Community Right-To-Know List.
|
Safety Data |
|
 |