| Identification | |
| Name: | Ethacridine lactate monohydrate |
| Synonyms: | 7-ethoxyacridine-3,9-diamine;Aethacridinum; |
| CAS: | 6402-23-9 |
| EINECS: | 217-408-1 |
| Molecular Formula: | C15H15N3O.C3H6O3.H2O |
| Molecular Weight: | 361.39 |
| InChI: | InChI=1/C15H15N3O/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13/h3-8H,2,16H2,1H3,(H2,17,18)/p+1 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | white powder |
| Specification: | yellow powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
