| Identification | |
| Name: | 1-Butene, 3,4-dichloro- |
| Synonyms: | 1,2-Dichloro-3-butene;3,4-Dichloro-1-butene |
| CAS: | 64037-54-3 |
| Molecular Formula: | C4H6 Cl2 |
| Molecular Weight: | 125.00 |
| InChI: | InChI=1S/C4H6Cl2/c1-2-4(6)3-5/h2,4H,1,3H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -61 deg C |
| Flash Point: | 28.3°C |
| Boiling Point: | 116°Cat760mmHg |
| Density: | 1.108g/cm3 |
| Solubility: | 420 mg/l of water; soluble in polar solvents. Soluble in ethanol, ether and benzene Very soluble in benzene and chloroform. |
| Flash Point: | 28.3°C |
| Color: | COLORLESS LIQ |
| Safety Data | |
 |
|
