| Identification | |
| Name: | N-(2-Chloroethyl)-N-nitrosoacetamide |
| Synonyms: | N-(2-chloroethyl)-N-nitroso-acetamide;N-(beta-Chloroethyl)-N-nitrosoacetamide;ACETAMIDE, N-(2-CHLOROETHYL)-N-NITROSO-; |
| CAS: | 64057-51-8 |
| Molecular Formula: | C4H7ClN2O2 |
| Molecular Weight: | 150.58 |
| InChI: | InChI=1/C4H7ClN2O2/c1-4(8)7(6-9)3-2-5/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 70.8°C |
| Boiling Point: | 193.5°C at 760 mmHg |
| Density: | 1.3g/cm3 |
| Refractive index: | 1.503 |
| Specification: |
N-(beta-Chloroethyl)-N-nitrosoacetamide (CAS NO.64057-51-8) is also named as 4-04-00-03387 (Beilstein Handbook Reference) ; BRN 1766112 ; N-(2-Chloroethyl)-N-nitrosoacetamide ; Acetamide, N-(2-chloroethyl)-N-nitroso- . N-(beta-Chloroethyl)-N-nitrosoacetamide (CAS NO.64057-51-8) is highly toxic. It is flammable. It will produce toxic nitrogen oxide and chloride fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep N-(beta-Chloroethyl)-N-nitrosoacetamide (CAS NO.64057-51-8) separate from raw materials of food. |
| Flash Point: | 70.8°C |
| Safety Data | |
 |
|
