Identification |
Name: | 2-Imidazolidinone,1-[4-(2-phenyldiazenyl)phenyl]- |
Synonyms: | 2-Imidazolidinone,1-[4-(phenylazo)phenyl]- (9CI) |
CAS: | 64058-30-6 |
Molecular Formula: | C15H14 N4 O |
Molecular Weight: | 266.33 |
InChI: | InChI=1/C15H14N4O/c20-15(19-10-11-19)16-12-6-8-14(9-7-12)18-17-13-4-2-1-3-5-13/h1-9H,10-11H2,(H,16,20)/b18-17+ |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.26g/cm3 |
Refractive index: | 1.662 |
Specification: |
p-N-Cyclo ethyleneureidoazobenzene , its cas register number is 64058-30-6. It also can be called Azobenzen . When heated to decomposition it emits toxic fumes of NOx.
|
Flash Point: | °C |
Safety Data |
|
|