| Identification | |
| Name: | Acetamide,N-[1,1':4',1''-terphenyl]-4-yl- (9CI) |
| Synonyms: | Acetanilide,4'-(4-biphenylyl)- (7CI); Acetanilide, p-(p-phenylphenyl)- (2CI); Terphenyl,p-acetamido- (2CI) |
| CAS: | 64058-92-0 |
| Molecular Formula: | C20H17 N O |
| Molecular Weight: | 287.38 |
| InChI: | InChI=1/C20H17NO/c21-20(22)14-15-6-8-17(9-7-15)19-12-10-18(11-13-19)16-4-2-1-3-5-16/h1-13H,14H2,(H2,21,22) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 284°C |
| Boiling Point: | 546.1°C at 760 mmHg |
| Density: | 1.133g/cm3 |
| Refractive index: | 1.615 |
| Specification: |
p-Terphenyl-4-ylacetamide , its cas register number is 64058-92-0. It also can be called 4-Acetylamino-p-diphenylbenzene ; Acetamide, p-terphenyl-4-yl- ; and 4-Acetylamino-p-terphenyl . |
| Flash Point: | 284°C |
| Safety Data | |
 |
|
