Identification |
Name: | Acetamide,N-[1,1':4',1''-terphenyl]-4-yl- (9CI) |
Synonyms: | Acetanilide,4'-(4-biphenylyl)- (7CI); Acetanilide, p-(p-phenylphenyl)- (2CI); Terphenyl,p-acetamido- (2CI) |
CAS: | 64058-92-0 |
Molecular Formula: | C20H17 N O |
Molecular Weight: | 287.38 |
InChI: | InChI=1/C20H17NO/c21-20(22)14-15-6-8-17(9-7-15)19-12-10-18(11-13-19)16-4-2-1-3-5-16/h1-13H,14H2,(H2,21,22) |
Molecular Structure: |
 |
Properties |
Flash Point: | 284°C |
Boiling Point: | 546.1°C at 760 mmHg |
Density: | 1.133g/cm3 |
Refractive index: | 1.615 |
Specification: |
p-Terphenyl-4-ylacetamide , its cas register number is 64058-92-0. It also can be called 4-Acetylamino-p-diphenylbenzene ; Acetamide, p-terphenyl-4-yl- ; and 4-Acetylamino-p-terphenyl .
|
Flash Point: | 284°C |
Safety Data |
|
 |