| Identification | |
| Name: | 6H-Dibenzo[b,d]pyran-6-one,3,7,9-trihydroxy-1-methyl- |
| Synonyms: | Alternariol(6CI,7CI); NSC 638263 |
| CAS: | 641-38-3 |
| Molecular Formula: | C14H10 O5 |
| Molecular Weight: | 258.24 |
| InChI: | InChI=1/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3462 6.1/PG 1 |
| Flash Point: | 232.286°C |
| Boiling Point: | 586.894°C at 760 mmHg |
| Density: | 1.563g/cm3 |
| Refractive index: | 1.731 |
| Specification: |
1. Alternariol (CAS NO.641-38-3) can be called 3,4,4'-Trihydroxy-6'-methyl-2-biphenylcarboxylic acid,gamma lactone ; 6H-Dibenzo(b,d)pyran-6-one, 1-methyl-3,7,9-trihydroxy- ; AOH . |
| Packinggroup: | III |
| Flash Point: | 232.286°C |
| Storage Temperature: | 2-8°C |
| Usage: | An alternaria mycotoxin and genotoxin, found in common edible crops. It inhibits the activity of various DNA-topoisomerases, increasing he rate of DNA strand breaks. |
| Safety Data | |
 |
|
