| Identification | |
| Name: | D-Mannitol,1,4:3,6-dianhydro- |
| Synonyms: | Mannitol,1,4:3,6-dianhydro-, D- (8CI);Furo[3,2-b]furan, D-mannitol deriv.;(+)-Isomannide;1,4:3,6-Dianhydro-D-mannitol;1,4:3,6-Dianhydromannitol;Isomannide;NSC 270938; |
| CAS: | 641-74-7 |
| EINECS: | 211-374-1 |
| Molecular Formula: | C6H10O4 |
| Molecular Weight: | 146.1412 |
| InChI: | InChI=1/C6H10O4/c7-3-1-9-6-4(8)2-10-5(3)6/h3-8H,1-2H2/t3-,4-,5?,6?/m0/s1 |
| Molecular Structure: | ![(C6H10O4) Mannitol,1,4:3,6-dianhydro-, D- (8CI);Furo[3,2-b]furan, D-mannitol deriv.;(+)-Isomannide;1,4:3,6-Dia...](https://img1.guidechem.com/chem/e/dict/101/641-74-7.jpg) |
| Properties | |
| Melting Point: | 80-85 ºC |
| Density: | 1.475 g/cm3 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.562 |
| Alpha: | 89 º (C=3, H2O) |
| Solubility: | Very soluble |
| Appearance: | Off White Crystals |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry place in tightly closed containers. |
| Safety Data | |
 |
|
