| Identification | |
| Name: | 2,3-Difluoro Phenol |
| Synonyms: | 2,3-Difluorophenol |
| CAS: | 6418-38-8 |
| EINECS: | 264-750-2 |
| Molecular Formula: | C6H4F2O |
| Molecular Weight: | 130.09 |
| InChI: | InChI=1/C6H4F2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.351 g/cm3? |
| Refractive index: | 1.495? |
| Appearance: | white crystalline low melting mass |
| Specification: | white crystalline low melting mass usageEng:Intermediates of Liquid Crystals Safety Statements:26-45-36/37/39-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Flammables area |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
