Identification |
Name: | 2H-1-Benzopyran-2-one,4,7-dihydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]- |
Synonyms: | 4,7-Dihydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-1-benzopyran-2-one;rac 7-Hydroxy Acenocoumarol |
CAS: | 64180-12-7 |
Molecular Formula: | C19H15 N O7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C19H15NO7/c1-10(21)8-15(11-2-4-12(5-3-11)20(25)26)17-18(23)14-7-6-13(22)9-16(14)27-19(17)24/h2-7,9,15,22-23H,8H2,1H3 |
Molecular Structure: |
![(C19H15NO7) 4,7-Dihydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]-2H-1-benzopyran-2-one;rac 7-Hydroxy Acenocoumarol](https://img1.guidechem.com/chem/e/dict/0/64180-12-7.jpg) |
Properties |
Flash Point: | 347.1°C |
Boiling Point: | 650.3°C at 760 mmHg |
Density: | 1.501g/cm3 |
Refractive index: | 1.679 |
Flash Point: | 347.1°C |
Usage: | A metabolite of Acenocoumarol with anticoagulant activity. |
Safety Data |
|
![](/images/detail_15.png) |