| Identification | |
| Name: | Glycine,N-[(phenylmethoxy)carbonyl]-, ethenyl ester |
| Synonyms: | N-Carbobenzoxyglycinevinyl ester |
| CAS: | 64187-24-2 |
| Molecular Formula: | C12H13 N O4 |
| Molecular Weight: | 235.26 |
| InChI: | InChI=1/C12H13NO4/c1-2-16-11(14)8-13-12(15)17-9-10-6-4-3-5-7-10/h2-7H,1,8-9H2,(H,13,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 178.5°C |
| Boiling Point: | 371.5°C at 760 mmHg |
| Density: | 1.181g/cm3 |
| Refractive index: | 1.526 |
| Specification: |
N-Carbobenzoxyglycine vinyl ester , its cas register number is 64187-24-2. It also can be called BRN 1985589 ; Glycine, N-benzyloxycarbonyl-, vinyl ester, L- . It is oderately toxic. When heated to decomposition it emits toxic fumes of NOx. The storage environment of N-Carbobenzoxyglycine vinyl ester (CAS NO.64187-24-2) should be ventilate, low-temperature and dry. |
| Flash Point: | 178.5°C |
| Safety Data | |
 |
|
