| Identification | |
| Name: | Glycine,N-[(phenylmethoxy)carbonyl]-, 1,2-dibromoethyl ester |
| Synonyms: | N-Carbobenzoxyglycine1,2-dibromoethyl ester |
| CAS: | 64187-25-3 |
| Molecular Formula: | C12H13 Br2 N O4 |
| Molecular Weight: | 395.08 |
| InChI: | InChI=1/C12H13Br2NO4/c13-6-10(14)19-11(16)7-15-12(17)18-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 250.9°C |
| Boiling Point: | 491.3°C at 760 mmHg |
| Density: | 1.711g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
N-Carbobenzoxyglycine 1,2-dibromoethyl ester , its cas register number is 64187-25-3. It also can be called BRN 2002986 ; Glycine, N-benzyloxycarbonyl-, 1,2-dibromoethyl ester, L- .When N-Carbobenzoxyglycine 1,2-dibromoethyl ester (CAS NO.64187-25-3) is heated to decomposition it emits toxic fumes of Br− and NOx. |
| Flash Point: | 250.9°C |
| Safety Data | |
 |
|
