| Identification | |
| Name: | L-Leucine,N-[(phenylmethoxy)carbonyl]-, ethenyl ester |
| Synonyms: | N-Carbobenzoxy-L-leucinevinyl ester |
| CAS: | 64187-27-5 |
| Molecular Formula: | C16H21 N O4 |
| Molecular Weight: | 291.38 |
| InChI: | InChI=1/C16H21NO4/c1-4-20-15(18)14(10-12(2)3)17-16(19)21-11-13-8-6-5-7-9-13/h4-9,12,14H,1,10-11H2,2-3H3,(H,17,19)/t14-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.4°C |
| Boiling Point: | 411.1°Cat760mmHg |
| Density: | 1.095g/cm3 |
| Refractive index: | 1.51 |
| Specification: |
N-Carbobenzoxy-L-leucine vinyl ester , its cas register number is 64187-27-5. It also can be called BRN 2001060 ; L-Leucine, N-((phenylmethoxy)carbonyl)-, ethenyl ester ; L-N-Carboxyleucine N-benzyl 1-vinyl ester . When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 202.4°C |
| Safety Data | |
 |
|
