| Identification | |
| Name: | 9-Anthraldehyde |
| Synonyms: | 9-Anthraldehyde(6CI,7CI,8CI);9-Anthracenecarbaldehyde;9-Anthracenemethanal;9-Formylanthracene;NSC 15; |
| CAS: | 642-31-9 |
| EINECS: | 211-383-0 |
| Molecular Formula: | C15H10O |
| Molecular Weight: | 206.2393 |
| InChI: | InChI=1S/C15H10O/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.217 g/cm3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.745 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | yellow crystalline powder |
| Specification: | yellow powder Safety Statements:24/25-36 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29122900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols | |
 |
|
