| Identification | |
| Name: | 1,5-Naphthyridin-2(1H)-one,3-nitro- |
| Synonyms: | 2-Hydroxy-3-nitro-1,5-naphthyridine |
| CAS: | 64222-33-9 |
| Molecular Formula: | C8H5 N3 O3 |
| Molecular Weight: | 191.14 |
| InChI: | InChI=1/C8H5N3O3/c12-8-7(11(13)14)4-6-5(10-8)2-1-3-9-6/h1-4H,(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189.676°C |
| Boiling Point: | 390.017°C at 760 mmHg |
| Density: | 1.54 |
| Refractive index: | 1.744 |
| Specification: |
The 3-Nitro-1,5-naphthyridin-2(1H)-one, with the cas registry number 64222-33-9, has the systematic name of 3-nitro-1,5-naphthyridin-2-ol. And the molecular formula of the chemical is C8H5N3O3. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.64; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 6; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 91.83Å2; (11)Index of Refraction: 1.744; (12)Molar Refractivity: 48.705 cm3; (13)Molar Volume: 120.268 cm3; (14)Polarizability: 19.308×10-24cm3; (15)Surface Tension: 89.48 dyne/cm; (16)Density: 1.589 g/cm3; (17)Flash Point: 189.676 °C; (18)Enthalpy of Vaporization: 66.442 kJ/mol; (19)Boiling Point: 390.017 °C at 760 mmHg; (20)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 189.676°C |
| Safety Data | |
 |
|
