| Identification | |
| Name: | Hydrazinecarboxylicacid, 2-[6-[ethyl(2-hydroxypropyl)amino]-3-pyridazinyl]-, ethyl ester |
| Synonyms: | CGP 18684E;Cadral; Cadralazine; Cadraten; Cadrilan; DC 826; ISF 2469; Presmode |
| CAS: | 64241-34-5 |
| Molecular Formula: | C12H21 N5 O3 |
| Molecular Weight: | 283.38 |
| InChI: | InChI=1/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.253 g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
Cadralazine (CAS NO.64241-34-5) is an antihypertensive of the hydrazine chemical class. |
| Safety Data | |
 |
|
