| Identification |
| Name: | 3,4-difluorobenzonitrile |
| Synonyms: | 3,4-Difluorobenznitriled; LABOTEST-BB LT00847816; 4-CYANO-1,2-DIFLUOROBENZENE |
| CAS: | 64248-62-0 |
| EINECS: | 264-751-8 |
| Molecular Formula: | C7H3F2N |
| Molecular Weight: | 139.1 |
| InChI: | InChI=1/C7H3F2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1325 |
| Density: | 1.26 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.486 |
| Solubility: | Slightly soluble |
| Appearance: | white to light yellow crystal powder |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
