| Identification | |
| Name: | D-chiro-Inositol |
| Synonyms: | Inositol,D-chiro- (8CI);(+)-chiro-Inositol;D-(+)-chiro-Inositol;D-Inositol; |
| CAS: | 643-12-9 |
| EINECS: | 211-394-0 |
| Molecular Formula: | C6H12O6 |
| Molecular Weight: | 180.15588 |
| InChI: | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 230 ºC |
| Flash Point: | 143.4 ºC |
| Boiling Point: | 291.3 ºC at 760 mmHg |
| Density: | 2.038 g/cm3 |
| Refractive index: | 1.784 |
| Water Solubility: | 0.35 in water |
| Solubility: | 0.35 in water |
| Appearance: | off-white powder |
| Specification: | Off-White Powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29061390 |
| Flash Point: | 143.4 ºC |
| Storage Temperature: | Freezer |
| Safety Data | |
 |
|
