| Identification | |
| Name: | 2-Methyl-1,1'-biphenyl |
| Synonyms: | 2-Methylbiphenyl |
| CAS: | 643-58-3 |
| EINECS: | 211-400-1 |
| Molecular Formula: | C13H12 |
| Molecular Weight: | 168.24 |
| InChI: | InChI=1/C13H12/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12/h2-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 255.3ºC |
| Density: | 1.011 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.59-1.592 |
| Solubility: | Insoluble |
| Appearance: | white crystal powder |
| Specification: |
2-Phenyltoluene , its cas register number is 643-58-3. It also can be called 1-Methyl-2-phenylbenzene ; 2-Methyl-1,1'-biphenyl ; 2-Methylbiphenyl ; o-Methylbiphenyl ; o-Phenyltoluene ; 1,1'-Biphenyl, 2-methyl- .It is a clear colorless liquid. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
