| Identification | |
| Name: | 7H-Furo[3,2-g][1]benzopyran-7-one,3-(aminomethyl)-2,5,9-trimethyl- |
| Synonyms: | 4'-Aminomethyl-4,5,8-trimethylpsoralen;4'-Aminomethyl-4,5',8-trimethylpsoralen; 4'-Aminomethyltrioxsalen; Trioxsalenamine |
| CAS: | 64358-50-5 |
| Molecular Formula: | C15H15 N O3 |
| Molecular Weight: | 257.28 |
| InChI: | InChI=1/C15H15NO3.ClH/c1-7-4-13(17)19-14-8(2)15-11(5-10(7)14)12(6-16)9(3)18-15;/h4-5H,6,16H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 8/PG 2 |
| Flash Point: | 228°C |
| Boiling Point: | 453.4°C at 760 mmHg |
| Specification: | Safety Statements:26-27-36-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 228°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
