| Identification | |
| Name: | 4-Thiazolecarboxylicacid, 2-methyl-, ethyl ester |
| Synonyms: | 2-Methyl-1,3-thiazole-4-carboxylicacid ethyl ester; 2-Methylthiazole-4-carboxylic acid ethyl ester; Ethyl 2-methyl-1,3-thiazole-4-carboxylate;Ethyl 2-methyl-4-thiazolecarboxylate; NSC 159893 |
| CAS: | 6436-59-5 |
| Molecular Formula: | C7H9 N O2 S |
| Molecular Weight: | 171.21 |
| InChI: | InChI=1/C7H9NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.198 g/cm3 |
| Refractive index: | 1.528 |
| Specification: |
4-Thiazolecarboxylicacid, 2-methyl-, ethyl ester , with CAS number of 6436-59-5, can be called Ethyl 2-methyl-1,3-thiazole-4-carboxylate ; 2-Methyl-thiazole-4-carboxylic acid ethyl ester ; Ethyl 2-methylthiazole-4-carboxylate . It is a light yellow to brown powde. |
| Storage Temperature: | Refrigerated. |
| Safety Data | |
 |
|
