| Identification | |
| Name: | 2,5-Furandione, polymer with 1,2-ethanediol and 3a,4,7,7a-tetrahydro-4,7-methano-1H-indene |
| Synonyms: | 2,5-Furandione, polymer with 1,2-ethanediol and 3a,4,7,7a-tetrahydro-4,7-methano-1H-indene;2,5-furandione, polymer with 1,2-ethanediol and 3a,4,7,7a-tetrahydro-4,7-methan;Ethylene glycol, maleic anhydride, and dicyclopentadiene polymer;Ethylene glycol,maleic anhydride,and dicyclopentadiene polymer;Maleic anhydride, ethylene glycol, dicyclopentadiene polymer;o-1h-indene;2,5-FURANDIONE, POLYMER WITH 1,2-ETHANEDIOL AND 3ALPHA,4,7,7ALPHA- TETRAHYDRO-4,7-METHANO-1H-INDENE |
| CAS: | 64386-66-9 |
| Molecular Formula: | C16H20O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C10H12.C4H2O3.C2H6O2/c1-2-9-7-4-5-8(6-7)10(9)3-1;5-3-1-2-4(6)7-3;3-1-2-4/h1-2,4-5,7-10H,3,6H2;1-2H;3-4H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Safety Data | |
 |
|
