| Identification | |
| Name: | 2H-1-Benzopyran,6,7-dimethoxy-2,2-dimethyl- |
| Synonyms: | 6,7-Dimethoxy-2,2-dimethyl-2H-chromene;Ageratochromene; Ageratochromene II; NSC 318792; Precocene 2; Precocene II |
| CAS: | 644-06-4 |
| EINECS: | 211-408-5 |
| Molecular Formula: | C13H16 O3 |
| Molecular Weight: | 220.29 |
| InChI: | InChI=1/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 47.50C |
| Flash Point: | 113 °C |
| Boiling Point: | 300.4°C at 760 mmHg |
| Density: | 1.063g/cm3 |
| Refractive index: | 1.513 |
| Specification: | Crystalline Solid usageEng:Anti-juvenile hormones found in plants that induce reversible precocious metamorphosis and sterilization in insects by suppressing the function of the corpora allata gland |
| Flash Point: | 113 °C |
| Usage: | Anti-juvenile hormones found in plants that induce reversible precocious metamorphosis and sterilization in insects by suppressing the function of the corpora allata gland |
| Safety Data | |
 |
|
