| Identification | ||
| Name: | Dichlorophenylphosphine | |
| CAS: | 644-97-3 | |
| EINECS: | 211-425-8 | |
| Molecular Formula: | C6H5Cl2P | |
| Molecular Weight: | 178.98 | |
| InChI: | InChI=1/C6H5Cl2P/c7-9(8)6-4-2-1-3-5-6/h1-5H | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2798/2845 | |
| Flash Point: | 102 C | |
| Density: | 1.319 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.597-1.599 | |
| Water Solubility: | Reacts | |
| Solubility: | Decomposes SOLVENT | |
| Appearance: | clear liquid | |
| Packinggroup: | II | |
| HS Code: | 29310095 | |
| Flash Point: | 102 C | |
| Storage Temperature: | Keep container closed when not in use. Corrosives area. Store protected from moisture. | |
| Sensitive: | Moisture Sensitive | |
| Color: | COLORLESS LIQUID | |
| Usage: | Organic synthesis, for derivation of plasticizers, polymers, antioxidants, oil additives. | |
| Safety Data | ||
| Hazard Symbols |
F:Flammable
|
|
 |
||
