| Identification | |
| Name: | Phenol, 2-methyl-, polymer with formaldehyde, oxiranyl methyl ester |
| Synonyms: | Formaldehyde, polymer with 2-methylphenol, glycidyl ether;formaldehyde, polymer with 2-methylphenol, glycidylether;Formaldehyde,polymer with 2-methylphenol,glycidyl ether;Phenol, 2-methyl, formaldehyde, oxiranyl methyl ether polymer;Phenol, 2-methyl-, polymer with formaldehyde, oxiranyl methyl ester;o-cresol/ formaldehyde/ glycidyl ether copolymer |
| CAS: | 64425-89-4 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H12O2.CH2O/c1-8-4-2-3-5-10(8)12-7-9-6-11-9;1-2/h2-5,9H,6-7H2,1H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 99.1°C |
| Boiling Point: | 268°C at 760 mmHg |
| Flash Point: | 99.1°C |
| Safety Data | |
 |
|
