| Identification | |
| Name: | 2-(2-Methoxyphenoxy)ethylamine hydrochloride |
| Synonyms: | Ethanamine,2-(2-methoxyphenoxy)-, hydrochloride (9CI);Ethylamine, 2-(o-methoxyphenoxy)-,hydrochloride (7CI); |
| CAS: | 64464-07-9 |
| Molecular Formula: | C9H13NO2.HCl |
| Molecular Weight: | 203.67 |
| InChI: | InChI=1/C9H13NO2.ClH/c1-11-8-4-2-3-5-9(8)12-7-6-10;/h2-5H,6-7,10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Appearance: | white solid |
| Specification: |
?2-(2-Methoxyphenoxy)ethylamine hydrochloride , its CAS NO. is 64464-07-9, the synonyms are 2-(2-Methoxphenoxyl) Ethylamine HCl ; 2-(2-Aminoethoxy)anisole Hydrochloride . |
| Usage: | Impurity of Carvedilol synthesis. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
