Identification |
Name: | 1-Iodo-3-nitrobenzene |
Synonyms: | 3-Iodonitrobenzene |
CAS: | 645-00-1 |
EINECS: | 211-427-9 |
Molecular Formula: | C6H4INO2 |
Molecular Weight: | 249.01 |
InChI: | InChI=1/C6H4INO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H |
Molecular Structure: |
 |
Properties |
Transport: | UN 1325 |
Density: | 2.018 g/cm3 |
Stability: | Stable. Highly flammable. Incompatible with strong bases, strong oxidizing agents. |
Refractive index: | 1.663 |
Water Solubility: | insoluble |
Solubility: | insoluble in water |
Appearance: | yellow to yellow-green powder |
Packinggroup: | I; II; III |
Sensitive: | Light Sensitive |
Safety Data |
Hazard Symbols |
F:Flammable
Xn:Harmful
|
|
 |