| Identification | |
| Name: | 1,3,5-Triazine-2,4,6-triamine,N2,N2,N4,N4,N6,N6-hexamethyl- |
| Synonyms: | 2,4,6-Tris(dimethylamino)-1,3,5-triazine;2,4,6-Tris(dimethylamino)-s-triazine;Hexamethylmelamine; |
| CAS: | 645-05-6 |
| EINECS: | 211-428-4 |
| Molecular Formula: | C9H18N6 |
| Molecular Weight: | 210.33 |
| InChI: | InChI=1/C9H24N6/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6/h7-9H2,1-6H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 301 |
| Density: | 1.148 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.569 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | Colorless crystalline solid |
| Report: |
EPA Genetic Toxicology Program. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Needles from absolute ethanol Solid |
| Usage: | An antitumor agent which also acts as a chemosterilant for male houseflies and other insects. Antineoplastic. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
