| Identification |
| Name: | 3-Hydroxy-4-methoxybenzoic acid |
| Synonyms: | Isovanillicacid (6CI); p-Anisic acid, 3-hydroxy- (7CI,8CI); 3-Hydroxy-4-methoxybenzoicacid; 3-Hydroxy-p-anisic acid; 4-Methoxy-3-hydroxybenzoic acid;5-Carboxy-2-methoxyphenol |
| CAS: | 645-08-9 |
| EINECS: | 211-430-5 |
| Molecular Formula: | C8H8O4 |
| Molecular Weight: | 168.14672 |
| InChI: | InChI=1S/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | STABILITY |
| Density: | 1.351 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | White to light yellow crystalline powder |
| Flash Point: | STABILITY |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
