| Identification | |
| Name: | Bis(p-nitrophenyl)phosphate |
| Synonyms: | Phenol,p-nitro-, hydrogen phosphate (6CI,7CI); Phosphoric acid, bis(p-nitrophenyl)ester (8CI); BNPP; Bis(4-nitrophenyl) hydrogen phosphate; Bis(4-nitrophenyl)phosphate; Bis(4-nitrophenyl)phosphoric acid; Bis(p-nitrophenyl) hydrogenphosphate; Bis(p-nitrophenyl) phosphate; Bis-PNPP; Di-p-nitrophenyl phosphate;NSC 59824; p-Nitrophenyl monohydrogen phosphate |
| CAS: | 645-15-8 |
| EINECS: | 211-434-7 |
| Molecular Formula: | C12H9N2O8P |
| Molecular Weight: | 340.18 |
| InChI: | InChI=1/C12H9N2O8P/c15-13(16)9-1-5-11(6-2-9)21-23(19,20)22-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.614 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White-like or yellowish crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Inhibitor of enzyme. It is used for Phosphodiesterase Substrate. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
