| Identification | |
| Name: | 1,2-Benzenediol,4-(2-aminoethyl)-, hydrobromide (1:1) |
| Synonyms: | 1,2-Benzenediol,4-(2-aminoethyl)-, hydrobromide (9CI); Pyrocatechol, 4-(2-aminoethyl)-,hydrobromide (8CI); 3-Hydroxytyramine hydrobromide; Dopamine hydrobromide |
| CAS: | 645-31-8 |
| EINECS: | 200-110-0 |
| Molecular Formula: | C8H11 N O2 . Br H |
| Molecular Weight: | 234.09 |
| InChI: | InChI=1/C8H11NO2.BrH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 218-220 °C(lit.) |
| Flash Point: | 158°C |
| Boiling Point: | 337.7°C at 760 mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Gray - white, fine powder. |
| Specification: | Safety Statements:26-37/39-37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 37:Wear suitable gloves |
| Flash Point: | 158°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Medication. |
| Safety Data | |
 |
|
