| Identification | |
| Name: | cis-Stilbene |
| Synonyms: | cis-1,1-(1,2-Ethenediyl)bis(benzene); cis-Stilbene, (cis-1,2-Diphenylethylene); ((E)-2-phenylethenyl)benzene ; Stilbebe; 95%; cis-1,2-Diphenylethylene; cis-Stilbebe |
| CAS: | 645-49-8 |
| EINECS: | 211-445-7 |
| Molecular Formula: | C14H12 |
| Molecular Weight: | 180.24508 |
| InChI: | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 °F |
| Density: | 1.01 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.622(lit.) |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: |
|
| Appearance: | Pale yellow liquid |
| Specification: | pale yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | >230 °F |
| Color: | LIQUID YELLOW OIL |
| Safety Data | |
 |
|
