| Identification | |
| Name: | 4-n-Propylphenol |
| Synonyms: | - |
| CAS: | 645-56-7 |
| EINECS: | 211-446-2 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C9H12O/c1-2-3-8-4-6-9(10)7-5-8/h4-7,10H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3145 |
| Melting Point: | 22°C |
| Flash Point: | 223? |
| Density: | 0.983 |
| Stability: | No data. |
| Refractive index: | 1.523 |
| Solubility: | Insoluble |
| Appearance: | Yellow liquid. |
| Specification: | CLEAR YELLOW LIQUID usageEng:Intermediates of Liquid Crystals Safety Statements:26-28-36/37/39-45-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29071900 |
| Flash Point: | 223? |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
