| Identification | |
| Name: | 2-Hexenal, 2-ethyl- |
| Synonyms: | 2-Ethyl-2-hexen-1-al;2-Ethyl-2-hexenal; 2-Ethyl-3-propylacrolein; 3-Formylhept-3-ene; CKB 1364; NSC4787; a-Ethyl-2-hexenal; a-Ethyl-b-propylacrolein |
| CAS: | 645-62-5 |
| EINECS: | 211-448-3 |
| Molecular Formula: | C8H14 O |
| Molecular Weight: | 126.19616 |
| InChI: | InChI=1S/C8H14O/c1-3-5-6-8(4-2)7-9/h6-7H,3-5H2,1-2H3/b8-6+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1760 |
| Flash Point: | 68 C |
| Boiling Point: | 175 C |
| Density: | 0,85 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.431 |
| Water Solubility: | slight Stability Stable. Combustible. Incompatible with strong oxidizingagents. Toxicology Strong respiratory, skin and eye irritant. Toxicity data (The meaning |
| Solubility: | slight
|
| Appearance: | colourless liquid with a strong smell |
| Specification: | colourless liquid with a strong smell Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 68 C |
| Color: | COLORLESS LIQUID YELLOW LIQUID |
| Safety Data | |
| Hazard Symbols | |
 |
|
