| Identification | |
| Name: | Butanedioic acid,1,4-dipentyl ester |
| Synonyms: | Butanedioicacid, dipentyl ester (9CI);Succinic acid, dipentyl ester (7CI,8CI);Di(n-pentyl) succinate;Diamyl succinate;Dipentyl succinate;NSC 1501; |
| CAS: | 645-69-2 |
| EINECS: | 211-452-5 |
| Molecular Formula: | C14H26O4 |
| Molecular Weight: | 258.36 |
| InChI: | InChI=1/C14H26O4/c1-3-5-7-11-17-13(15)9-10-14(16)18-12-8-6-4-2/h3-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.969 g/cm3 |
| Refractive index: | 1.441 |
| Specification: |
The cas register number of Dipentyl succinate is 645-69-2. It also can be called as butanedioic acid, dipentyl ester and the Systematic name about this chemical is Butanedioic acid, dipenyl ester. Physical properties about Dipentyl succinate are: (1)ACD/LogP: 4.45 ; (2)# of Rule of 5 Violations: 0 ; (3)ACD/LogD (pH 5.5): 4.45 ; (4)ACD/LogD (pH 7.4): 4.45 ; (5)ACD/BCF (pH 5.5): 1415.87; (6)ACD/BCF (pH 7.4): 1415.87; (7)ACD/KOC (pH 5.5): 6267.59; (8)ACD/KOC (pH 7.4): 6267.59; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 13; (12)Polar Surface Area: 52.6Å2; (13)Index of Refraction: 1.441; (14)Molar Refractivity: 70.45 cm3; (15)Molar Volume: 266.5 cm3; (16)Surface Tension: 32.9 dyne/cm; (17)Density: 0.969 g/cm3; (18)Flash Point: 135 °C; (19)Enthalpy of Vaporization: 54.1 kJ/mol; (20)Boiling Point: 300.9 °C at 760 mmHg; (21)Vapour Pressure: 0.00109 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
