| Identification | |
| Name: | 4-Iodo-2,5-dimethoxyphenethylamine hydrochloride |
| Synonyms: | Benzeneethanamine,4-iodo-2,5-dimethoxy-, hydrochloride (9CI);2,5-Dimethoxy-4-iodophenylethylaminehydrochloride; |
| CAS: | 64584-32-3 |
| Molecular Formula: | C10H15ClINO2 |
| Molecular Weight: | 343.58907 |
| InChI: | InChI=1/C10H14INO2/c1-13-9-6-8(11)10(14-2)5-7(9)3-4-12/h5-6H,3-4,12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.089°C |
| Boiling Point: | 354.324°C at 760 mmHg |
| Density: | 1.567g/cm3 |
| Refractive index: | 1.584 |
| Specification: | Brown Solid usageEng:A new designer drug 2C-I, a psychedelic drug and phenethylamine of the 2C family. |
| Flash Point: | 168.089°C |
| Storage Temperature: | -20?C Freezer, Under Inert Atmosphere |
| Usage: |
It can be used as a new designer drug 2C-I, a psychedelic drug and phenethylamine of the 2C family. |
| Safety Data | |
 |
|
