| Identification |
| Name: | 4-methylvaleric acid |
| Synonyms: | Valericacid, 4-methyl- (6CI,8CI); 4,4-Dimethylbutanoic acid; 4-Methylpentanoic acid;4-Methylvaleric acid; Isobutylacetic acid; Isocaproic acid; Isohexanoic acid;Isohexoic acid; NSC 4126 |
| CAS: | 646-07-1 |
| EINECS: | 211-464-0 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 0.922 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.4136-1.4156 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | slightly brown liquid |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Corrosives area. Store in a cool, dry area away from incompatible substances. |
| Usage: | Used as an intermediate in the manufacture of plasticizers, pharmaceuticals, and perfumes; occurs naturally in many edible plants and dairy products. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
Xn:Harmful
|
| |
 |
