| Identification |
| Name: | octanoic acid, compound with 2-(isopropylamino)ethanol (1:1) |
| Synonyms: | Octanoic acid, compd. with 2-((1-methylethyl)amino)ethanol (1:1);Caprylic acid, isopropylaminoethanol salt;Octanoic acid, compound with 2-(isopropylamino)ethanol (1:1);octanoic acid - 2-(propan-2-ylamino)ethanol (1:1) |
| CAS: | 64601-13-4 |
| EINECS: | 264-958-3 |
| Molecular Formula: | C13H29NO3 |
| Molecular Weight: | 247.3743 |
| InChI: | InChI=1/C8H16O2.C5H13NO/c1-2-3-4-5-6-7-8(9)10;1-5(2)6-3-4-7/h2-7H2,1H3,(H,9,10);5-7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 107.4°C |
| Boiling Point: | 239.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 107.4°C |
| Safety Data |
| |
 |
