| Identification |
| Name: | 1,2-dibromo-4,5-difluorobenzene |
| Synonyms: | 1,2-Dibromo-4,5-difluorobenzene;1,2-Difluoro-4,5-dibromobenzene; NSC 10239 |
| CAS: | 64695-78-9 |
| EINECS: | 265-021-1 |
| Molecular Formula: | C6H2Br2F2 |
| Molecular Weight: | 271.88 |
| InChI: | InChI=1/C6H2Br2F2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1325 |
| Density: | 2.087 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.338 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white to yellow, low melting solid |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
