| Identification |
| Name: | Mordant Yellow 12 |
| Synonyms: | Mordant yellow?2 |
| CAS: | 6470-98-0 |
| EINECS: | 229-302-2 |
| Molecular Formula: | C13H10N3NaO3 |
| Molecular Weight: | 279.23 |
| InChI: | InChI=1/C13H11N3O3.Na/c14-8-1-3-9(4-2-8)15-16-10-5-6-12(17)11(7-10)13(18)19;/h1-7,17H,14H2,(H,18,19);/q;+1/p-1/b16-15+; |
| Molecular Structure: |
 |
| Properties |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Gold brown to brown powder solid. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
