| Identification | |
| Name: | Gabapentin-lactam |
| Synonyms: | 3,3-Pentamethylene-4-butyrolactam;2-Azaspiro[4.5]decan-3-one; |
| CAS: | 64744-50-9 |
| EINECS: | 451-630-1 |
| Molecular Formula: | C9H15NO |
| Molecular Weight: | 153.22 |
| InChI: | InChI=1/C9H15NO/c11-8-6-9(7-10-8)4-2-1-3-5-9/h1-7H2,(H,10,11) |
| Molecular Structure: | ![(C9H15NO) 3,3-Pentamethylene-4-butyrolactam;2-Azaspiro[4.5]decan-3-one;](https://img1.guidechem.com/chem/e/dict/17/64744-50-9.jpg) |
| Properties | |
| Melting Point: | 84-89 °C(lit.) |
| Boiling Point: | 181 °C / 13mmHg |
| Density: | 1.05 g/cm3 |
| Refractive index: | 1.509 |
| Appearance: | white solid |
| Usage: | Gabapentin Lactam reduces protein aggregates and improves motor performance in a transgenic mouse model of Huntington disease. It opens mitochondrial ATP-dependent potassium channels |
| Safety Data | |
 |
|
