| Identification | |
| Name: | Phosphine,dicyclohexylphenyl- |
| Synonyms: | Dicyclohexylphenylphosphine;Phenyldicyclohexylphosphine |
| CAS: | 6476-37-5 |
| EINECS: | 229-334-7 |
| Molecular Formula: | C18H27 P |
| Molecular Weight: | 274.38 |
| InChI: | InChI=1/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | White to off-white crystalline powder |
| Specification: |
Dicyclohexylphenylphosphine , its CAS NO. is 6476-37-5, the synonyms are Phosphine, dicyclohexylphenyl- ; Phenylphosphinodicyclohexane ; Phosphine, dicyclohexylphenyl- ; Dicyclohexylphosphine, polymer-bound . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
