| Identification | |
| Name: | 2,4-Pyrrolidinedicarboxylicacid, (2S,4R)- |
| Synonyms: | 2,4-Pyrrolidinedicarboxylicacid, (2S-trans)-;L-trans-Pyrrolidine-2,4-dicarboxylic acid;trans-4-Carboxy-L-proline;(2S,4R)-Pyrrolidine-2,4-dicarboxylic acid; |
| CAS: | 64769-66-0 |
| Molecular Formula: | C6H9NO4 |
| Molecular Weight: | 159.14 |
| InChI: | InChI=1/C6H9NO4/c8-5(9)3-1-4(6(10)11)7-2-3/h3-4,7H,1-2H2,(H,8,9)(H,10,11)/t3-,4+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.456 g/cm3 |
| Refractive index: | 1.534 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Potent, competitive, transportable EAAT1-4 inhibitor/non-transportable EAAT5 inhibitor. Also available as part of the Excitatory Amino Acid Transporter Inhibitor Tocriset™ . |
| Storage Temperature: | Store at RT |
| Safety Data | |
 |
|
